C66H58N2+2 — CID 11804241
4-(2,4,6-triphenylphenyl)-1-[8-[4-(2,4,6-triphenylphenyl)pyridin-1-ium-1-yl]octyl]pyridin-1-ium (PubChem CID 11804241) has the molecular formula C66H58N2+2 and a molecular weight of 879.20 g/mol. Its IUPAC name is 4-(2,4,6-triphenylphenyl)-1-[8-[4-(2,4,6-triphenylphenyl)pyridin-1-ium-1-yl]octyl]pyridin-1-ium.
| Compound Name | 4-(2,4,6-triphenylphenyl)-1-[8-[4-(2,4,6-triphenylphenyl)pyridin-1-ium-1-yl]octyl]pyridin-1-ium |
|---|---|
| PubChem CID | 11804241 |
| Molecular Formula | C66H58N2+2 |
| Molecular Weight | 879.20 g/mol |
| Exact Mass | 878.46 |
| IUPAC Name | 4-(2,4,6-triphenylphenyl)-1-[8-[4-(2,4,6-triphenylphenyl)pyridin-1-ium-1-yl]octyl]pyridin-1-ium |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c(-c3cc[n+](CCCCCCCC[n+]4ccc(-c5c(-c6ccccc6)cc(-c6ccccc6)cc5-c5ccccc5)cc4)cc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C66H58N2/c1(3-23-41-67-43-37-57(38-44-67)65-61(53-29-15-7-16-30-53)47-59(51-25-11-5-12-26-51)48-62(65)54-31-17-8-18-32-54)2-4-24-42-68-45-39-58(40-46-68)66-63(55-33-19-9-20-34-55)49-60(52-27-13-6-14-28-52)50-64(66)56-35-21-10-22-36-56/h5-22,25-40,43-50H,1-4,23-24,41-42H2/q+2 |
| InChIKey | GXRXJFDBYRHGTK-UHFFFAOYSA-N |
| XLogP | 16.64 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.20 |
| LogP ≤ 5 | 16.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|