About 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene
1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene (PubChem CID 68955843) has the molecular formula C24H17Cl
and a molecular weight of 340.85 g/mol. Its IUPAC name is 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene.
Molecular Properties
| Compound Name | 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene |
| PubChem CID | 68955843 |
| Molecular Formula | C24H17Cl |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene |
| SMILES | Clc1cc2cc-2c1-c1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H7Cl.C12H10/c13-11-7-9-6-10(9)12(11)8-4-2-1-3-5-8;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-7H;1-10H |
| InChIKey | GHGUCYUJTPECFS-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene?
The IUPAC name of 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene (CID 68955843) is 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene.
What is the SMILES notation for 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene?
The canonical SMILES for 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene is Clc1cc2cc-2c1-c1ccccc1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene?
The InChIKey is GHGUCYUJTPECFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl.C12H10/c13-11-7-9-6-10(9)12(11)8-4-2-1-3-5-8;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-7H;1-10H.
What are the key properties of 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene?
1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene has a molecular weight of 340.85 g/mol, XLogP of 7.34, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;3-chloro-2-phenylbicyclo[3.1.0]hexa-1,3,5-triene is sourced from PubChem (CID 68955843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).