About 2-(3-Chlorophenyl)-1,3,5-triphenylbenzene
2-(3-Chlorophenyl)-1,3,5-triphenylbenzene (PubChem CID 169275191) has the molecular formula C30H21Cl
and a molecular weight of 416.90 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1,3,5-triphenylbenzene.
Molecular Properties
| Compound Name | 2-(3-Chlorophenyl)-1,3,5-triphenylbenzene |
| PubChem CID | 169275191 |
| Molecular Formula | C30H21Cl |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-(3-chlorophenyl)-1,3,5-triphenylbenzene |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C(=C2)C3=CC=CC=C3)C4=CC(=CC=C4)Cl)C5=CC=CC=C5 |
| InChI | InChI=1S/C30H21Cl/c31-27-18-10-17-25(19-27)30-28(23-13-6-2-7-14-23)20-26(22-11-4-1-5-12-22)21-29(30)24-15-8-3-9-16-24/h1-21H |
| InChIKey | GGRPIOIQUHKSQJ-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | 497 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(3-Chlorophenyl)-1,3,5-triphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-Chlorophenyl)-1,3,5-triphenylbenzene?
The IUPAC name of 2-(3-Chlorophenyl)-1,3,5-triphenylbenzene (CID 169275191) is 2-(3-chlorophenyl)-1,3,5-triphenylbenzene.
What is the SMILES notation for 2-(3-Chlorophenyl)-1,3,5-triphenylbenzene?
The canonical SMILES for 2-(3-Chlorophenyl)-1,3,5-triphenylbenzene is C1=CC=C(C=C1)C2=CC(=C(C(=C2)C3=CC=CC=C3)C4=CC(=CC=C4)Cl)C5=CC=CC=C5.
What is the InChIKey of 2-(3-Chlorophenyl)-1,3,5-triphenylbenzene?
The InChIKey is GGRPIOIQUHKSQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H21Cl/c31-27-18-10-17-25(19-27)30-28(23-13-6-2-7-14-23)20-26(22-11-4-1-5-12-22)21-29(30)24-15-8-3-9-16-24/h1-21H.
What are the key properties of 2-(3-Chlorophenyl)-1,3,5-triphenylbenzene?
2-(3-Chlorophenyl)-1,3,5-triphenylbenzene has a molecular weight of 416.90 g/mol, XLogP of 9.50, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-Chlorophenyl)-1,3,5-triphenylbenzene is sourced from PubChem (CID 169275191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).