C22H12Cl2O8 — CID 139733778
3,6-bis(3-chlorophenyl)benzene-1,2,4,5-tetracarboxylic acid (PubChem CID 139733778) has the molecular formula C22H12Cl2O8 and a molecular weight of 475.24 g/mol. Its IUPAC name is 3,6-bis(3-chlorophenyl)benzene-1,2,4,5-tetracarboxylic acid.
| Compound Name | 3,6-bis(3-chlorophenyl)benzene-1,2,4,5-tetracarboxylic acid |
|---|---|
| PubChem CID | 139733778 |
| Molecular Formula | C22H12Cl2O8 |
| Molecular Weight | 475.24 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | 3,6-bis(3-chlorophenyl)benzene-1,2,4,5-tetracarboxylic acid |
| SMILES | O=C(O)c1c(C(=O)O)c(-c2cccc(Cl)c2)c(C(=O)O)c(C(=O)O)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H12Cl2O8/c23-11-5-1-3-9(7-11)13-15(19(25)26)17(21(29)30)14(10-4-2-6-12(24)8-10)18(22(31)32)16(13)20(27)28/h1-8H,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | DCKPSBWOPSCXJG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.24 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |