C12H11ClN2O2 — CID 122619967
3-(3-chlorophenyl)-1,5-dimethylpyrazole-4-carboxylic acid (PubChem CID 122619967) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.69 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,5-dimethylpyrazole-4-carboxylic acid.
| Compound Name | 3-(3-chlorophenyl)-1,5-dimethylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 122619967 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 3-(3-chlorophenyl)-1,5-dimethylpyrazole-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)c(-c2cccc(Cl)c2)nn1C |
| InChI | InChI=1S/C12H11ClN2O2/c1-7-10(12(16)17)11(14-15(7)2)8-4-3-5-9(13)6-8/h3-6H,1-2H3,(H,16,17) |
| InChIKey | PLNJTJQKEPTIRY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |