C10H7ClN2O3 — CID 84700819
3-(3-chlorophenyl)-5-oxo-1,2-dihydropyrazole-4-carboxylic acid (PubChem CID 84700819) has the molecular formula C10H7ClN2O3 and a molecular weight of 238.63 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-oxo-1,2-dihydropyrazole-4-carboxylic acid.
| Compound Name | 3-(3-chlorophenyl)-5-oxo-1,2-dihydropyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 84700819 |
| Molecular Formula | C10H7ClN2O3 |
| Molecular Weight | 238.63 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 3-(3-chlorophenyl)-5-oxo-1,2-dihydropyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1c(-c2cccc(Cl)c2)[nH][nH]c1=O |
| InChI | InChI=1S/C10H7ClN2O3/c11-6-3-1-2-5(4-6)8-7(10(15)16)9(14)13-12-8/h1-4H,(H,15,16)(H2,12,13,14) |
| InChIKey | YCJVKBBDXIHCRM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.63 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |