C12H9Br2NaO3S — CID 173085882
sodium;2,5-dibromo-4-phenylbenzenesulfonic acid;hydride (PubChem CID 173085882) has the molecular formula C12H9Br2NaO3S and a molecular weight of 416.07 g/mol. Its IUPAC name is sodium;2,5-dibromo-4-phenylbenzenesulfonic acid;hydride.
| Compound Name | sodium;2,5-dibromo-4-phenylbenzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 173085882 |
| Molecular Formula | C12H9Br2NaO3S |
| Molecular Weight | 416.07 g/mol |
| Exact Mass | 413.85 |
| IUPAC Name | sodium;2,5-dibromo-4-phenylbenzenesulfonic acid;hydride |
| SMILES | O=S(=O)(O)c1cc(Br)c(-c2ccccc2)cc1Br.[H-].[Na+] |
| InChI | InChI=1S/C12H8Br2O3S.Na.H/c13-10-7-12(18(15,16)17)11(14)6-9(10)8-4-2-1-3-5-8;;/h1-7H,(H,15,16,17);;/q;+1;-1 |
| InChIKey | DGOKZKIJGMVQHN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.07 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|