C13H9BrO — CID 101071715
4-bromo-2-phenylcyclohepta-2,4,6-trien-1-one (PubChem CID 101071715) has the molecular formula C13H9BrO and a molecular weight of 261.12 g/mol. Its IUPAC name is 4-bromo-2-phenylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 4-bromo-2-phenylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 101071715 |
| Molecular Formula | C13H9BrO |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | 4-bromo-2-phenylcyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1cccc(Br)cc1-c1ccccc1 |
| InChI | InChI=1S/C13H9BrO/c14-11-7-4-8-13(15)12(9-11)10-5-2-1-3-6-10/h1-9H |
| InChIKey | ZODBNHIRUUJORN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |