C10H8Br2 — CID 144708258
1,3-dibromocyclodeca-1,3,5,7,9-pentaene (PubChem CID 144708258) has the molecular formula C10H8Br2 and a molecular weight of 287.98 g/mol. Its IUPAC name is 1,3-dibromocyclodeca-1,3,5,7,9-pentaene.
| Compound Name | 1,3-dibromocyclodeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 144708258 |
| Molecular Formula | C10H8Br2 |
| Molecular Weight | 287.98 g/mol |
| Exact Mass | 285.90 |
| IUPAC Name | 1,3-dibromocyclodeca-1,3,5,7,9-pentaene |
| SMILES | Brc1cccccccc(Br)c1 |
| InChI | InChI=1S/C10H8Br2/c11-9-6-4-2-1-3-5-7-10(12)8-9/h1-8H/b2-1+,3-1+,4-2-,5-3-,6-4-,7-5-,9-6+,9-8-,10-7+,10-8- |
| InChIKey | HJQPXSRGZBSRNS-YVDGESFOSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.98 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |