About 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene
9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene (PubChem CID 160714288) has the molecular formula C26H15BrCl2
and a molecular weight of 478.22 g/mol. Its IUPAC name is 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene.
Molecular Properties
| Compound Name | 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene |
| PubChem CID | 160714288 |
| Molecular Formula | C26H15BrCl2 |
| Molecular Weight | 478.22 g/mol |
| Exact Mass | 475.97 |
| IUPAC Name | 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene |
| SMILES | Clc1cccc2c(-c3ccc(Br)cc3)c3c(Cl)cccc3c(-c3ccccc3)c12 |
| InChI | InChI=1S/C26H15BrCl2/c27-18-14-12-17(13-15-18)24-20-9-5-10-21(28)25(20)23(16-6-2-1-3-7-16)19-8-4-11-22(29)26(19)24/h1-15H |
| InChIKey | HBQABDREABVIBI-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.22 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene?
The IUPAC name of 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene (CID 160714288) is 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene.
What is the SMILES notation for 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene?
The canonical SMILES for 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene is Clc1cccc2c(-c3ccc(Br)cc3)c3c(Cl)cccc3c(-c3ccccc3)c12.
What is the InChIKey of 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene?
The InChIKey is HBQABDREABVIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H15BrCl2/c27-18-14-12-17(13-15-18)24-20-9-5-10-21(28)25(20)23(16-6-2-1-3-7-16)19-8-4-11-22(29)26(19)24/h1-15H.
What are the key properties of 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene?
9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene has a molecular weight of 478.22 g/mol, XLogP of 9.40, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-bromophenyl)-1,5-dichloro-10-phenylanthracene is sourced from PubChem (CID 160714288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).