C11H4Cl3NS — CID 11781215
1,4,5-trichloroindeno[2,1-d]thiazine (PubChem CID 11781215) has the molecular formula C11H4Cl3NS and a molecular weight of 288.59 g/mol. Its IUPAC name is 1,4,5-trichloroindeno[2,1-d]thiazine.
| Compound Name | 1,4,5-trichloroindeno[2,1-d]thiazine |
|---|---|
| PubChem CID | 11781215 |
| Molecular Formula | C11H4Cl3NS |
| Molecular Weight | 288.59 g/mol |
| Exact Mass | 286.91 |
| IUPAC Name | 1,4,5-trichloroindeno[2,1-d]thiazine |
| SMILES | Clc1nsc(Cl)c2c3ccccc3c(Cl)c1-2 |
| InChI | InChI=1S/C11H4Cl3NS/c12-9-6-4-2-1-3-5(6)7-8(9)10(13)15-16-11(7)14/h1-4H |
| InChIKey | UOXCNZKDKNBASC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |