C13H9Cl2NOS — CID 174925751
1-(3,4-dichloro-1,2-thiazol-5-yl)-1-phenylbut-2-yn-1-ol (PubChem CID 174925751) has the molecular formula C13H9Cl2NOS and a molecular weight of 298.19 g/mol. Its IUPAC name is 1-(3,4-dichloro-1,2-thiazol-5-yl)-1-phenylbut-2-yn-1-ol.
| Compound Name | 1-(3,4-dichloro-1,2-thiazol-5-yl)-1-phenylbut-2-yn-1-ol |
|---|---|
| PubChem CID | 174925751 |
| Molecular Formula | C13H9Cl2NOS |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 1-(3,4-dichloro-1,2-thiazol-5-yl)-1-phenylbut-2-yn-1-ol |
| SMILES | CC#CC(O)(c1ccccc1)c1snc(Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl2NOS/c1-2-8-13(17,9-6-4-3-5-7-9)11-10(14)12(15)16-18-11/h3-7,17H,1H3 |
| InChIKey | GEAQNEOJIRGJFT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|