About magnesium;1,1-diphenylbut-2-yn-1-olate;chloride
magnesium;1,1-diphenylbut-2-yn-1-olate;chloride (PubChem CID 162464571) has the molecular formula C16H13ClMgO
and a molecular weight of 281.04 g/mol. Its IUPAC name is magnesium;1,1-diphenylbut-2-yn-1-olate;chloride.
Molecular Properties
| Compound Name | magnesium;1,1-diphenylbut-2-yn-1-olate;chloride |
| PubChem CID | 162464571 |
| Molecular Formula | C16H13ClMgO |
| Molecular Weight | 281.04 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | magnesium;1,1-diphenylbut-2-yn-1-olate;chloride |
| SMILES | CC#CC([O-])(c1ccccc1)c1ccccc1.[Cl-].[Mg+2] |
| InChI | InChI=1S/C16H13O.ClH.Mg/c1-2-13-16(17,14-9-5-3-6-10-14)15-11-7-4-8-12-15;;/h3-12H,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | NQYWIMNOZVBKBK-UHFFFAOYSA-M |
| XLogP | -1.06 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.04 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1,1-diphenylbut-2-yn-1-olate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1,1-diphenylbut-2-yn-1-olate;chloride?
The IUPAC name of magnesium;1,1-diphenylbut-2-yn-1-olate;chloride (CID 162464571) is magnesium;1,1-diphenylbut-2-yn-1-olate;chloride.
What is the SMILES notation for magnesium;1,1-diphenylbut-2-yn-1-olate;chloride?
The canonical SMILES for magnesium;1,1-diphenylbut-2-yn-1-olate;chloride is CC#CC([O-])(c1ccccc1)c1ccccc1.[Cl-].[Mg+2].
What is the InChIKey of magnesium;1,1-diphenylbut-2-yn-1-olate;chloride?
The InChIKey is NQYWIMNOZVBKBK-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H13O.ClH.Mg/c1-2-13-16(17,14-9-5-3-6-10-14)15-11-7-4-8-12-15;;/h3-12H,1H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;1,1-diphenylbut-2-yn-1-olate;chloride?
magnesium;1,1-diphenylbut-2-yn-1-olate;chloride has a molecular weight of 281.04 g/mol, XLogP of -1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1,1-diphenylbut-2-yn-1-olate;chloride is sourced from PubChem (CID 162464571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).