C17H26 — CID 143798052
ethane;2,5,5-trimethylhex-3-yn-2-ylbenzene (PubChem CID 143798052) has the molecular formula C17H26 and a molecular weight of 230.40 g/mol. Its IUPAC name is ethane;2,5,5-trimethylhex-3-yn-2-ylbenzene.
| Compound Name | ethane;2,5,5-trimethylhex-3-yn-2-ylbenzene |
|---|---|
| PubChem CID | 143798052 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | ethane;2,5,5-trimethylhex-3-yn-2-ylbenzene |
| SMILES | CC.CC(C)(C)C#CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H20.C2H6/c1-14(2,3)11-12-15(4,5)13-9-7-6-8-10-13;1-2/h6-10H,1-5H3;1-2H3 |
| InChIKey | SWBNVYXFCQGZBZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|