C26H26 — CID 102219495
9,10-bis(3,3-dimethylbut-1-ynyl)anthracene (PubChem CID 102219495) has the molecular formula C26H26 and a molecular weight of 338.49 g/mol. Its IUPAC name is 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene.
| Compound Name | 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene |
|---|---|
| PubChem CID | 102219495 |
| Molecular Formula | C26H26 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene |
| SMILES | CC(C)(C)C#Cc1c2ccccc2c(C#CC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C26H26/c1-25(2,3)17-15-23-19-11-7-9-13-21(19)24(16-18-26(4,5)6)22-14-10-8-12-20(22)23/h7-14H,1-6H3 |
| InChIKey | UGGDCXZMCMYPHO-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|