About 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene
9,10-bis(3,3-dimethylbut-1-ynyl)anthracene (PubChem CID 102219495) has the molecular formula C26H26
and a molecular weight of 338.49 g/mol. Its IUPAC name is 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene.
Molecular Properties
| Compound Name | 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene |
| PubChem CID | 102219495 |
| Molecular Formula | C26H26 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene |
| SMILES | CC(C)(C)C#Cc1c2ccccc2c(C#CC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C26H26/c1-25(2,3)17-15-23-19-11-7-9-13-21(19)24(16-18-26(4,5)6)22-14-10-8-12-20(22)23/h7-14H,1-6H3 |
| InChIKey | UGGDCXZMCMYPHO-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene?
The IUPAC name of 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene (CID 102219495) is 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene.
What is the SMILES notation for 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene?
The canonical SMILES for 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene is CC(C)(C)C#Cc1c2ccccc2c(C#CC(C)(C)C)c2ccccc12.
What is the InChIKey of 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene?
The InChIKey is UGGDCXZMCMYPHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26/c1-25(2,3)17-15-23-19-11-7-9-13-21(19)24(16-18-26(4,5)6)22-14-10-8-12-20(22)23/h7-14H,1-6H3.
What are the key properties of 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene?
9,10-bis(3,3-dimethylbut-1-ynyl)anthracene has a molecular weight of 338.49 g/mol, XLogP of 6.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-bis(3,3-dimethylbut-1-ynyl)anthracene is sourced from PubChem (CID 102219495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).