C23H24 — CID 143354437
2,2-dimethylpropane;triphenylene (PubChem CID 143354437) has the molecular formula C23H24 and a molecular weight of 300.44 g/mol. Its IUPAC name is 2,2-dimethylpropane;triphenylene.
| Compound Name | 2,2-dimethylpropane;triphenylene |
|---|---|
| PubChem CID | 143354437 |
| Molecular Formula | C23H24 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 2,2-dimethylpropane;triphenylene |
| SMILES | CC(C)(C)C.c1ccc2c(c1)c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C18H12.C5H12/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;1-5(2,3)4/h1-12H;1-4H3 |
| InChIKey | NILBYJFEIVZJRB-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|