C20H28 — CID 163647560
1,4-ditert-butyl-2,3-dimethylnaphthalene (PubChem CID 163647560) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,3-dimethylnaphthalene.
| Compound Name | 1,4-ditert-butyl-2,3-dimethylnaphthalene |
|---|---|
| PubChem CID | 163647560 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1,4-ditert-butyl-2,3-dimethylnaphthalene |
| SMILES | Cc1c(C)c(C(C)(C)C)c2ccccc2c1C(C)(C)C |
| InChI | InChI=1S/C20H28/c1-13-14(2)18(20(6,7)8)16-12-10-9-11-15(16)17(13)19(3,4)5/h9-12H,1-8H3 |
| InChIKey | DVTYRFRNRBPWPH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |