C21H28O — CID 165167993
4-tert-butyl-1,1,2,2,5-pentamethylbenzo[e][1]benzofuran (PubChem CID 165167993) has the molecular formula C21H28O and a molecular weight of 296.45 g/mol. Its IUPAC name is 4-tert-butyl-1,1,2,2,5-pentamethylbenzo[e][1]benzofuran.
| Compound Name | 4-tert-butyl-1,1,2,2,5-pentamethylbenzo[e][1]benzofuran |
|---|---|
| PubChem CID | 165167993 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 4-tert-butyl-1,1,2,2,5-pentamethylbenzo[e][1]benzofuran |
| SMILES | Cc1c(C(C)(C)C)c2c(c3ccccc13)C(C)(C)C(C)(C)O2 |
| InChI | InChI=1S/C21H28O/c1-13-14-11-9-10-12-15(14)17-18(16(13)19(2,3)4)22-21(7,8)20(17,5)6/h9-12H,1-8H3 |
| InChIKey | SHNRTEBOCYCREW-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |