C34H38 — CID 150900181
9,10-bis(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)anthracene (PubChem CID 150900181) has the molecular formula C34H38 and a molecular weight of 446.68 g/mol. Its IUPAC name is 9,10-bis(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)anthracene.
| Compound Name | 9,10-bis(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)anthracene |
|---|---|
| PubChem CID | 150900181 |
| Molecular Formula | C34H38 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 9,10-bis(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)anthracene |
| SMILES | CC1=C(C)C(C)(c2c3ccccc3c(C3(C)C(C)=C(C)C(C)=C3C)c3ccccc23)C(C)=C1C |
| InChI | InChI=1S/C34H38/c1-19-20(2)24(6)33(9,23(19)5)31-27-15-11-13-17-29(27)32(30-18-14-12-16-28(30)31)34(10)25(7)21(3)22(4)26(34)8/h11-18H,1-10H3 |
| InChIKey | KZVPIKVCZVDMTF-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|