C50H46 — CID 139940303
6,11-ditert-butyl-1,2,3,4-tetraphenyl-5,12-dihydrotetracene (PubChem CID 139940303) has the molecular formula C50H46 and a molecular weight of 646.92 g/mol. Its IUPAC name is 6,11-ditert-butyl-1,2,3,4-tetraphenyl-5,12-dihydrotetracene.
| Compound Name | 6,11-ditert-butyl-1,2,3,4-tetraphenyl-5,12-dihydrotetracene |
|---|---|
| PubChem CID | 139940303 |
| Molecular Formula | C50H46 |
| Molecular Weight | 646.92 g/mol |
| Exact Mass | 646.36 |
| IUPAC Name | 6,11-ditert-butyl-1,2,3,4-tetraphenyl-5,12-dihydrotetracene |
| SMILES | CC(C)(C)c1c2c(c(C(C)(C)C)c3ccccc13)Cc1c(c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c1-c1ccccc1)C2 |
| InChI | InChI=1S/C50H46/c1-49(2,3)47-37-29-19-20-30-38(37)48(50(4,5)6)42-32-40-39(31-41(42)47)43(33-21-11-7-12-22-33)45(35-25-15-9-16-26-35)46(36-27-17-10-18-28-36)44(40)34-23-13-8-14-24-34/h7-30H,31-32H2,1-6H3 |
| InChIKey | VDQVZHQVHNDOBR-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.92 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |