C68H90 — CID 141273457
1,2,4,5-tetrakis(2,6-ditert-butylphenyl)-3-phenylbenzene (PubChem CID 141273457) has the molecular formula C68H90 and a molecular weight of 907.47 g/mol. Its IUPAC name is 1,2,4,5-tetrakis(2,6-ditert-butylphenyl)-3-phenylbenzene.
| Compound Name | 1,2,4,5-tetrakis(2,6-ditert-butylphenyl)-3-phenylbenzene |
|---|---|
| PubChem CID | 141273457 |
| Molecular Formula | C68H90 |
| Molecular Weight | 907.47 g/mol |
| Exact Mass | 906.70 |
| IUPAC Name | 1,2,4,5-tetrakis(2,6-ditert-butylphenyl)-3-phenylbenzene |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1-c1cc(-c2c(C(C)(C)C)cccc2C(C)(C)C)c(-c2c(C(C)(C)C)cccc2C(C)(C)C)c(-c2ccccc2)c1-c1c(C(C)(C)C)cccc1C(C)(C)C |
| InChI | InChI=1S/C68H90/c1-61(2,3)46-34-28-35-47(62(4,5)6)55(46)44-42-45(56-48(63(7,8)9)36-29-37-49(56)64(10,11)12)58(60-52(67(19,20)21)40-31-41-53(60)68(22,23)24)54(43-32-26-25-27-33-43)57(44)59-50(65(13,14)15)38-30-39-51(59)66(16,17)18/h25-42H,1-24H3 |
| InChIKey | LYRHXAYDZLIIJG-UHFFFAOYSA-N |
| XLogP | 20.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.47 |
| LogP ≤ 5 | 20.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |