C26H29O2P — CID 151365870
1,3-ditert-butyl-2-(5-phenyl-2-phosphorosooxyphenyl)benzene (PubChem CID 151365870) has the molecular formula C26H29O2P and a molecular weight of 404.49 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-(5-phenyl-2-phosphorosooxyphenyl)benzene.
| Compound Name | 1,3-ditert-butyl-2-(5-phenyl-2-phosphorosooxyphenyl)benzene |
|---|---|
| PubChem CID | 151365870 |
| Molecular Formula | C26H29O2P |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 1,3-ditert-butyl-2-(5-phenyl-2-phosphorosooxyphenyl)benzene |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1-c1cc(-c2ccccc2)ccc1OP=O |
| InChI | InChI=1S/C26H29O2P/c1-25(2,3)21-13-10-14-22(26(4,5)6)24(21)20-17-19(15-16-23(20)28-29-27)18-11-8-7-9-12-18/h7-17H,1-6H3 |
| InChIKey | OPKNKAPEOHUTAV-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|