C40H50 — CID 141103881
1,2-bis(2,4-ditert-butylphenyl)-4-phenylbenzene (PubChem CID 141103881) has the molecular formula C40H50 and a molecular weight of 530.84 g/mol. Its IUPAC name is 1,2-bis(2,4-ditert-butylphenyl)-4-phenylbenzene.
| Compound Name | 1,2-bis(2,4-ditert-butylphenyl)-4-phenylbenzene |
|---|---|
| PubChem CID | 141103881 |
| Molecular Formula | C40H50 |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.39 |
| IUPAC Name | 1,2-bis(2,4-ditert-butylphenyl)-4-phenylbenzene |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3ccccc3)cc2-c2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H50/c1-37(2,3)29-19-22-32(35(25-29)39(7,8)9)31-21-18-28(27-16-14-13-15-17-27)24-34(31)33-23-20-30(38(4,5)6)26-36(33)40(10,11)12/h13-26H,1-12H3 |
| InChIKey | OODGTPNWLFGYPU-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |