About 2,2-dimethylpropane;naphthalene
2,2-dimethylpropane;naphthalene (PubChem CID 91188461) has the molecular formula C15H20
and a molecular weight of 200.33 g/mol. Its IUPAC name is 2,2-dimethylpropane;naphthalene.
Molecular Properties
| Compound Name | 2,2-dimethylpropane;naphthalene |
| PubChem CID | 91188461 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2,2-dimethylpropane;naphthalene |
| SMILES | CC(C)(C)C.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C5H12/c1-2-6-10-8-4-3-7-9(10)5-1;1-5(2,3)4/h1-8H;1-4H3 |
| InChIKey | BICLFPXCMLRKMA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,2-dimethylpropane;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropane;naphthalene?
The IUPAC name of 2,2-dimethylpropane;naphthalene (CID 91188461) is 2,2-dimethylpropane;naphthalene.
What is the SMILES notation for 2,2-dimethylpropane;naphthalene?
The canonical SMILES for 2,2-dimethylpropane;naphthalene is CC(C)(C)C.c1ccc2ccccc2c1.
What is the InChIKey of 2,2-dimethylpropane;naphthalene?
The InChIKey is BICLFPXCMLRKMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C5H12/c1-2-6-10-8-4-3-7-9(10)5-1;1-5(2,3)4/h1-8H;1-4H3.
What are the key properties of 2,2-dimethylpropane;naphthalene?
2,2-dimethylpropane;naphthalene has a molecular weight of 200.33 g/mol, XLogP of 4.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropane;naphthalene is sourced from PubChem (CID 91188461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).