C18H19S+ — CID 10893590
3,3-dimethylbut-1-ynyl(diphenyl)sulfanium (PubChem CID 10893590) has the molecular formula C18H19S+ and a molecular weight of 267.42 g/mol. Its IUPAC name is 3,3-dimethylbut-1-ynyl(diphenyl)sulfanium.
| Compound Name | 3,3-dimethylbut-1-ynyl(diphenyl)sulfanium |
|---|---|
| PubChem CID | 10893590 |
| Molecular Formula | C18H19S+ |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 3,3-dimethylbut-1-ynyl(diphenyl)sulfanium |
| SMILES | CC(C)(C)C#C[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19S/c1-18(2,3)14-15-19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,1-3H3/q+1 |
| InChIKey | PSELNHAWQYJZRY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|