C17H22 — CID 135061212
[(3S)-3-ethenyl-6,6-dimethylhept-4-ynyl]benzene (PubChem CID 135061212) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is [(3S)-3-ethenyl-6,6-dimethylhept-4-ynyl]benzene.
| Compound Name | [(3S)-3-ethenyl-6,6-dimethylhept-4-ynyl]benzene |
|---|---|
| PubChem CID | 135061212 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | [(3S)-3-ethenyl-6,6-dimethylhept-4-ynyl]benzene |
| SMILES | C=C[C@@H](C#CC(C)(C)C)CCc1ccccc1 |
| InChI | InChI=1S/C17H22/c1-5-15(13-14-17(2,3)4)11-12-16-9-7-6-8-10-16/h5-10,15H,1,11-12H2,2-4H3/t15-/m1/s1 |
| InChIKey | MMDKYJMSJCUZMF-OAHLLOKOSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|