C17H28 — CID 54223968
(3-tert-butyl-4,4-dimethylpentyl)benzene (PubChem CID 54223968) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is (3-tert-butyl-4,4-dimethylpentyl)benzene.
| Compound Name | (3-tert-butyl-4,4-dimethylpentyl)benzene |
|---|---|
| PubChem CID | 54223968 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | (3-tert-butyl-4,4-dimethylpentyl)benzene |
| SMILES | CC(C)(C)C(CCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C17H28/c1-16(2,3)15(17(4,5)6)13-12-14-10-8-7-9-11-14/h7-11,15H,12-13H2,1-6H3 |
| InChIKey | KORWKQDITAZZFE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |