C27H32O — CID 66867219
4-[4-methyl-4-phenyl-3-(2-phenylpropan-2-yl)pentyl]phenol (PubChem CID 66867219) has the molecular formula C27H32O and a molecular weight of 372.55 g/mol. Its IUPAC name is 4-[4-methyl-4-phenyl-3-(2-phenylpropan-2-yl)pentyl]phenol.
| Compound Name | 4-[4-methyl-4-phenyl-3-(2-phenylpropan-2-yl)pentyl]phenol |
|---|---|
| PubChem CID | 66867219 |
| Molecular Formula | C27H32O |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 4-[4-methyl-4-phenyl-3-(2-phenylpropan-2-yl)pentyl]phenol |
| SMILES | CC(C)(c1ccccc1)C(CCc1ccc(O)cc1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C27H32O/c1-26(2,22-11-7-5-8-12-22)25(20-17-21-15-18-24(28)19-16-21)27(3,4)23-13-9-6-10-14-23/h5-16,18-19,25,28H,17,20H2,1-4H3 |
| InChIKey | PDMCTFRXUGUZMW-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |