About 4-(4-methylpentyl)phenol;phenol
4-(4-methylpentyl)phenol;phenol (PubChem CID 174866001) has the molecular formula C18H24O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-(4-methylpentyl)phenol;phenol.
Molecular Properties
| Compound Name | 4-(4-methylpentyl)phenol;phenol |
| PubChem CID | 174866001 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 4-(4-methylpentyl)phenol;phenol |
| SMILES | CC(C)CCCc1ccc(O)cc1.Oc1ccccc1 |
| InChI | InChI=1S/C12H18O.C6H6O/c1-10(2)4-3-5-11-6-8-12(13)9-7-11;7-6-4-2-1-3-5-6/h6-10,13H,3-5H2,1-2H3;1-5,7H |
| InChIKey | OZBKIIOZESNZJJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-methylpentyl)phenol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylpentyl)phenol;phenol?
The IUPAC name of 4-(4-methylpentyl)phenol;phenol (CID 174866001) is 4-(4-methylpentyl)phenol;phenol.
What is the SMILES notation for 4-(4-methylpentyl)phenol;phenol?
The canonical SMILES for 4-(4-methylpentyl)phenol;phenol is CC(C)CCCc1ccc(O)cc1.Oc1ccccc1.
What is the InChIKey of 4-(4-methylpentyl)phenol;phenol?
The InChIKey is OZBKIIOZESNZJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O.C6H6O/c1-10(2)4-3-5-11-6-8-12(13)9-7-11;7-6-4-2-1-3-5-6/h6-10,13H,3-5H2,1-2H3;1-5,7H.
What are the key properties of 4-(4-methylpentyl)phenol;phenol?
4-(4-methylpentyl)phenol;phenol has a molecular weight of 272.39 g/mol, XLogP of 4.76, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylpentyl)phenol;phenol is sourced from PubChem (CID 174866001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).