C26H49O3P — CID 175244550
1,4-bis(8-methylnonyl)benzene;phosphorous acid (PubChem CID 175244550) has the molecular formula C26H49O3P and a molecular weight of 440.65 g/mol. Its IUPAC name is 1,4-bis(8-methylnonyl)benzene;phosphorous acid.
| Compound Name | 1,4-bis(8-methylnonyl)benzene;phosphorous acid |
|---|---|
| PubChem CID | 175244550 |
| Molecular Formula | C26H49O3P |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | 1,4-bis(8-methylnonyl)benzene;phosphorous acid |
| SMILES | CC(C)CCCCCCCc1ccc(CCCCCCCC(C)C)cc1.OP(O)O |
| InChI | InChI=1S/C26H46.H3O3P/c1-23(2)15-11-7-5-9-13-17-25-19-21-26(22-20-25)18-14-10-6-8-12-16-24(3)4;1-4(2)3/h19-24H,5-18H2,1-4H3;1-3H |
| InChIKey | SWCNTOKLCQFCPC-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|