About 2-(4-methylpentyl)anthracene-9,10-diol
2-(4-methylpentyl)anthracene-9,10-diol (PubChem CID 86254465) has the molecular formula C20H22O2
and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-(4-methylpentyl)anthracene-9,10-diol.
Molecular Properties
| Compound Name | 2-(4-methylpentyl)anthracene-9,10-diol |
| PubChem CID | 86254465 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-(4-methylpentyl)anthracene-9,10-diol |
| SMILES | CC(C)CCCc1ccc2c(O)c3ccccc3c(O)c2c1 |
| InChI | InChI=1S/C20H22O2/c1-13(2)6-5-7-14-10-11-17-18(12-14)20(22)16-9-4-3-8-15(16)19(17)21/h3-4,8-13,21-22H,5-7H2,1-2H3 |
| InChIKey | FTIIQOARVOKECI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylpentyl)anthracene-9,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylpentyl)anthracene-9,10-diol?
The IUPAC name of 2-(4-methylpentyl)anthracene-9,10-diol (CID 86254465) is 2-(4-methylpentyl)anthracene-9,10-diol.
What is the SMILES notation for 2-(4-methylpentyl)anthracene-9,10-diol?
The canonical SMILES for 2-(4-methylpentyl)anthracene-9,10-diol is CC(C)CCCc1ccc2c(O)c3ccccc3c(O)c2c1.
What is the InChIKey of 2-(4-methylpentyl)anthracene-9,10-diol?
The InChIKey is FTIIQOARVOKECI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O2/c1-13(2)6-5-7-14-10-11-17-18(12-14)20(22)16-9-4-3-8-15(16)19(17)21/h3-4,8-13,21-22H,5-7H2,1-2H3.
What are the key properties of 2-(4-methylpentyl)anthracene-9,10-diol?
2-(4-methylpentyl)anthracene-9,10-diol has a molecular weight of 294.39 g/mol, XLogP of 5.38, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylpentyl)anthracene-9,10-diol is sourced from PubChem (CID 86254465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).