C20H22O2 — CID 86254465
2-(4-methylpentyl)anthracene-9,10-diol (PubChem CID 86254465) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-(4-methylpentyl)anthracene-9,10-diol.
| Compound Name | 2-(4-methylpentyl)anthracene-9,10-diol |
|---|---|
| PubChem CID | 86254465 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-(4-methylpentyl)anthracene-9,10-diol |
| SMILES | CC(C)CCCc1ccc2c(O)c3ccccc3c(O)c2c1 |
| InChI | InChI=1S/C20H22O2/c1-13(2)6-5-7-14-10-11-17-18(12-14)20(22)16-9-4-3-8-15(16)19(17)21/h3-4,8-13,21-22H,5-7H2,1-2H3 |
| InChIKey | FTIIQOARVOKECI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|