C31H40O2 — CID 118545812
2-[(E)-4,8-dimethylnon-3-enyl]-7-(4-methylpent-3-enyl)anthracene-9,10-diol (PubChem CID 118545812) has the molecular formula C31H40O2 and a molecular weight of 444.66 g/mol. Its IUPAC name is 2-[(E)-4,8-dimethylnon-3-enyl]-7-(4-methylpent-3-enyl)anthracene-9,10-diol.
| Compound Name | 2-[(E)-4,8-dimethylnon-3-enyl]-7-(4-methylpent-3-enyl)anthracene-9,10-diol |
|---|---|
| PubChem CID | 118545812 |
| Molecular Formula | C31H40O2 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 2-[(E)-4,8-dimethylnon-3-enyl]-7-(4-methylpent-3-enyl)anthracene-9,10-diol |
| SMILES | CC(C)=CCCc1ccc2c(O)c3ccc(CC/C=C(\C)CCCC(C)C)cc3c(O)c2c1 |
| InChI | InChI=1S/C31H40O2/c1-21(2)9-6-11-23(5)12-8-14-25-16-18-27-29(20-25)31(33)28-19-24(13-7-10-22(3)4)15-17-26(28)30(27)32/h10,12,15-21,32-33H,6-9,11,13-14H2,1-5H3/b23-12+ |
| InChIKey | ACPZCNZMIXADPJ-FSJBWODESA-N |
| XLogP | 9.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|