C53H62O4 — CID 123773215
10-[10-methoxy-2-(4-methylpent-3-enyl)-6-(4-methylpentyl)anthracen-9-yl]peroxy-2,7-bis(4-methylpent-3-enyl)anthracen-9-ol (PubChem CID 123773215) has the molecular formula C53H62O4 and a molecular weight of 763.07 g/mol. Its IUPAC name is 10-[10-methoxy-2-(4-methylpent-3-enyl)-6-(4-methylpentyl)anthracen-9-yl]peroxy-2,7-bis(4-methylpent-3-enyl)anthracen-9-ol.
| Compound Name | 10-[10-methoxy-2-(4-methylpent-3-enyl)-6-(4-methylpentyl)anthracen-9-yl]peroxy-2,7-bis(4-methylpent-3-enyl)anthracen-9-ol |
|---|---|
| PubChem CID | 123773215 |
| Molecular Formula | C53H62O4 |
| Molecular Weight | 763.07 g/mol |
| Exact Mass | 762.46 |
| IUPAC Name | 10-[10-methoxy-2-(4-methylpent-3-enyl)-6-(4-methylpentyl)anthracen-9-yl]peroxy-2,7-bis(4-methylpent-3-enyl)anthracen-9-ol |
| SMILES | COc1c2cc(CCCC(C)C)ccc2c(OOc2c3ccc(CCC=C(C)C)cc3c(O)c3cc(CCC=C(C)C)ccc23)c2cc(CCC=C(C)C)ccc12 |
| InChI | InChI=1S/C53H62O4/c1-34(2)14-10-18-38-22-26-42-46(30-38)50(54)47-31-39(19-11-15-35(3)4)23-27-43(47)52(42)56-57-53-45-29-25-40(20-12-16-36(5)6)32-48(45)51(55-9)44-28-24-41(33-49(44)53)21-13-17-37(7)8/h14-15,17,22-33,36,54H,10-13,16,18-21H2,1-9H3 |
| InChIKey | NWFKTLJGUGYHOE-UHFFFAOYSA-N |
| XLogP | 15.06 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.07 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|