C36H50O2 — CID 123850920
2-(4,8-dimethylnon-3-enyl)-6-(4,8-dimethylnon-7-enyl)anthracene-9,10-diol (PubChem CID 123850920) has the molecular formula C36H50O2 and a molecular weight of 514.79 g/mol. Its IUPAC name is 2-(4,8-dimethylnon-3-enyl)-6-(4,8-dimethylnon-7-enyl)anthracene-9,10-diol.
| Compound Name | 2-(4,8-dimethylnon-3-enyl)-6-(4,8-dimethylnon-7-enyl)anthracene-9,10-diol |
|---|---|
| PubChem CID | 123850920 |
| Molecular Formula | C36H50O2 |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.38 |
| IUPAC Name | 2-(4,8-dimethylnon-3-enyl)-6-(4,8-dimethylnon-7-enyl)anthracene-9,10-diol |
| SMILES | CC(C)=CCCC(C)CCCc1ccc2c(O)c3cc(CCC=C(C)CCCC(C)C)ccc3c(O)c2c1 |
| InChI | InChI=1S/C36H50O2/c1-25(2)11-7-13-27(5)15-9-17-29-19-21-31-33(23-29)35(37)32-22-20-30(24-34(32)36(31)38)18-10-16-28(6)14-8-12-26(3)4/h11,16,19-24,26-27,37-38H,7-10,12-15,17-18H2,1-6H3 |
| InChIKey | AFCHFTSWYKECOD-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|