C36H52O2 — CID 123174361
2-(4,8-dimethylnon-7-enyl)-7-(4-methylpentyl)-10-pentan-2-yloxyanthracen-9-ol (PubChem CID 123174361) has the molecular formula C36H52O2 and a molecular weight of 516.81 g/mol. Its IUPAC name is 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpentyl)-10-pentan-2-yloxyanthracen-9-ol.
| Compound Name | 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpentyl)-10-pentan-2-yloxyanthracen-9-ol |
|---|---|
| PubChem CID | 123174361 |
| Molecular Formula | C36H52O2 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.40 |
| IUPAC Name | 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpentyl)-10-pentan-2-yloxyanthracen-9-ol |
| SMILES | CCCC(C)Oc1c2ccc(CCCC(C)C)cc2c(O)c2cc(CCCC(C)CCC=C(C)C)ccc12 |
| InChI | InChI=1S/C36H52O2/c1-8-12-28(7)38-36-31-21-19-29(17-10-14-26(4)5)23-33(31)35(37)34-24-30(20-22-32(34)36)18-11-16-27(6)15-9-13-25(2)3/h13,19-24,26-28,37H,8-12,14-18H2,1-7H3 |
| InChIKey | LLVBPMBOHGZLLY-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|