C15H30 — CID 11252860
2,6-dimethyl-10-(trideuteriomethyl)dodec-2-ene (PubChem CID 11252860) has the molecular formula C15H30 and a molecular weight of 213.42 g/mol. Its IUPAC name is 2,6-dimethyl-10-(trideuteriomethyl)dodec-2-ene.
| Compound Name | 2,6-dimethyl-10-(trideuteriomethyl)dodec-2-ene |
|---|---|
| PubChem CID | 11252860 |
| Molecular Formula | C15H30 |
| Molecular Weight | 213.42 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | 2,6-dimethyl-10-(trideuteriomethyl)dodec-2-ene |
| SMILES | [2H]C([2H])([2H])C(CC)CCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C15H30/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h9,14-15H,6-8,10-12H2,1-5H3/i4D3 |
| InChIKey | PZSOILRADXWRKA-GKOSEXJESA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.42 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|