C50H52N2O4 — CID 59773760
7,17-bis[4-(3,7-dimethyloct-6-enyl)phenyl]-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),2,4,9,11,13,15(19)-heptaene-6,8,16,18-tetrone (PubChem CID 59773760) has the molecular formula C50H52N2O4 and a molecular weight of 744.98 g/mol. Its IUPAC name is 7,17-bis[4-(3,7-dimethyloct-6-enyl)phenyl]-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),2,4,9,11,13,15(19)-heptaene-6,8,16,18-tetrone.
| Compound Name | 7,17-bis[4-(3,7-dimethyloct-6-enyl)phenyl]-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),2,4,9,11,13,15(19)-heptaene-6,8,16,18-tetrone |
|---|---|
| PubChem CID | 59773760 |
| Molecular Formula | C50H52N2O4 |
| Molecular Weight | 744.98 g/mol |
| Exact Mass | 744.39 |
| IUPAC Name | 7,17-bis[4-(3,7-dimethyloct-6-enyl)phenyl]-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),2,4,9,11,13,15(19)-heptaene-6,8,16,18-tetrone |
| SMILES | CC(C)=CCCC(C)CCc1ccc(-n2c(=O)c3cc4cc5cc6c(=O)n(-c7ccc(CCC(C)CCC=C(C)C)cc7)c(=O)c6cc5cc4cc3c2=O)cc1 |
| InChI | InChI=1S/C50H52N2O4/c1-31(2)9-7-11-33(5)13-15-35-17-21-41(22-18-35)51-47(53)43-27-37-25-39-29-45-46(30-40(39)26-38(37)28-44(43)48(51)54)50(56)52(49(45)55)42-23-19-36(20-24-42)16-14-34(6)12-8-10-32(3)4/h9-10,17-30,33-34H,7-8,11-16H2,1-6H3 |
| InChIKey | LLBRZWOEQUOBAH-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.98 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|