C19H28O4 — CID 134231777
[(3S)-3,7-dimethyloct-6-enyl] 2-(4-hydroxy-3-methoxyphenyl)acetate (PubChem CID 134231777) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is [(3S)-3,7-dimethyloct-6-enyl] 2-(4-hydroxy-3-methoxyphenyl)acetate.
| Compound Name | [(3S)-3,7-dimethyloct-6-enyl] 2-(4-hydroxy-3-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 134231777 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | [(3S)-3,7-dimethyloct-6-enyl] 2-(4-hydroxy-3-methoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)OCC[C@@H](C)CCC=C(C)C)ccc1O |
| InChI | InChI=1S/C19H28O4/c1-14(2)6-5-7-15(3)10-11-23-19(21)13-16-8-9-17(20)18(12-16)22-4/h6,8-9,12,15,20H,5,7,10-11,13H2,1-4H3/t15-/m0/s1 |
| InChIKey | IDFVZPOHFYVQHW-HNNXBMFYSA-N |
| XLogP | 4.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|