About 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate
2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate (PubChem CID 134231770) has the molecular formula C17H18O5
and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate.
Molecular Properties
| Compound Name | 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate |
| PubChem CID | 134231770 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)OCCOc2ccccc2)ccc1O |
| InChI | InChI=1S/C17H18O5/c1-20-16-11-13(7-8-15(16)18)12-17(19)22-10-9-21-14-5-3-2-4-6-14/h2-8,11,18H,9-10,12H2,1H3 |
| InChIKey | JRNKIWUFOHOCTF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate?
The IUPAC name of 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate (CID 134231770) is 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate.
What is the SMILES notation for 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate?
The canonical SMILES for 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate is COc1cc(CC(=O)OCCOc2ccccc2)ccc1O.
What is the InChIKey of 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate?
The InChIKey is JRNKIWUFOHOCTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O5/c1-20-16-11-13(7-8-15(16)18)12-17(19)22-10-9-21-14-5-3-2-4-6-14/h2-8,11,18H,9-10,12H2,1H3.
What are the key properties of 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate?
2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate has a molecular weight of 302.33 g/mol, XLogP of 2.57, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyethyl 2-(4-hydroxy-3-methoxyphenyl)acetate is sourced from PubChem (CID 134231770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).