C22H21NO5 — CID 55638373
N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-(4-phenoxyphenoxy)acetamide (PubChem CID 55638373) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-(4-phenoxyphenoxy)acetamide.
| Compound Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-(4-phenoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 55638373 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]-2-(4-phenoxyphenoxy)acetamide |
| SMILES | COc1cc(CNC(=O)COc2ccc(Oc3ccccc3)cc2)ccc1O |
| InChI | InChI=1S/C22H21NO5/c1-26-21-13-16(7-12-20(21)24)14-23-22(25)15-27-17-8-10-19(11-9-17)28-18-5-3-2-4-6-18/h2-13,24H,14-15H2,1H3,(H,23,25) |
| InChIKey | DEPSREHVBNBZQY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |