C22H21NO4 — CID 7610854
N-[(2-methoxyphenyl)methyl]-2-(4-phenoxyphenoxy)acetamide (PubChem CID 7610854) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-2-(4-phenoxyphenoxy)acetamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-2-(4-phenoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 7610854 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-2-(4-phenoxyphenoxy)acetamide |
| SMILES | COc1ccccc1CNC(=O)COc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H21NO4/c1-25-21-10-6-5-7-17(21)15-23-22(24)16-26-18-11-13-20(14-12-18)27-19-8-3-2-4-9-19/h2-14H,15-16H2,1H3,(H,23,24) |
| InChIKey | DNLNLJSDRNZZSJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |