C17H18O4 — CID 11989799
3-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-1-phenylbutan-2-one (PubChem CID 11989799) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-1-phenylbutan-2-one.
| Compound Name | 3-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-1-phenylbutan-2-one |
|---|---|
| PubChem CID | 11989799 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-1-phenylbutan-2-one |
| SMILES | COc1cc(CC(O)C(=O)Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C17H18O4/c1-21-17-11-13(7-8-14(17)18)10-16(20)15(19)9-12-5-3-2-4-6-12/h2-8,11,16,18,20H,9-10H2,1H3 |
| InChIKey | WVPWCVLONNFAEL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |