C11H16O4 — CID 71398900
1-(4-hydroxy-3-methoxyphenyl)butane-2,3-diol (PubChem CID 71398900) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methoxyphenyl)butane-2,3-diol.
| Compound Name | 1-(4-hydroxy-3-methoxyphenyl)butane-2,3-diol |
|---|---|
| PubChem CID | 71398900 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)butane-2,3-diol |
| SMILES | COc1cc(CC(O)C(C)O)ccc1O |
| InChI | InChI=1S/C11H16O4/c1-7(12)10(14)5-8-3-4-9(13)11(6-8)15-2/h3-4,6-7,10,12-14H,5H2,1-2H3 |
| InChIKey | ZHTJWNGPKPVODR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |