C13H20O3 — CID 139528685
4-(2-hydroxy-4-methylpentyl)-2-methoxyphenol (PubChem CID 139528685) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-(2-hydroxy-4-methylpentyl)-2-methoxyphenol.
| Compound Name | 4-(2-hydroxy-4-methylpentyl)-2-methoxyphenol |
|---|---|
| PubChem CID | 139528685 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 4-(2-hydroxy-4-methylpentyl)-2-methoxyphenol |
| SMILES | COc1cc(CC(O)CC(C)C)ccc1O |
| InChI | InChI=1S/C13H20O3/c1-9(2)6-11(14)7-10-4-5-12(15)13(8-10)16-3/h4-5,8-9,11,14-15H,6-7H2,1-3H3 |
| InChIKey | KKKCAFHIFHKYAH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |