C20H24O5 — CID 55314701
2-(3-ethylphenoxy)ethyl 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 55314701) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-(3-ethylphenoxy)ethyl 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | 2-(3-ethylphenoxy)ethyl 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 55314701 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-(3-ethylphenoxy)ethyl 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | CCc1cccc(OCCOC(=O)Cc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H24O5/c1-4-15-6-5-7-17(12-15)24-10-11-25-20(21)14-16-8-9-18(22-2)19(13-16)23-3/h5-9,12-13H,4,10-11,14H2,1-3H3 |
| InChIKey | TZQLAJCAYRSLES-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|