C17H22O4 — CID 167362080
[(Z,3Z)-3-ethylidenehex-4-enyl] 2-(4-hydroxy-3-methoxyphenyl)acetate (PubChem CID 167362080) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(Z,3Z)-3-ethylidenehex-4-enyl] 2-(4-hydroxy-3-methoxyphenyl)acetate.
| Compound Name | [(Z,3Z)-3-ethylidenehex-4-enyl] 2-(4-hydroxy-3-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 167362080 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [(Z,3Z)-3-ethylidenehex-4-enyl] 2-(4-hydroxy-3-methoxyphenyl)acetate |
| SMILES | C/C=C\C(=C/C)CCOC(=O)Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C17H22O4/c1-4-6-13(5-2)9-10-21-17(19)12-14-7-8-15(18)16(11-14)20-3/h4-8,11,18H,9-10,12H2,1-3H3/b6-4-,13-5+ |
| InChIKey | YZYLZEUGZSAAJB-GLRUQPRCSA-N |
| XLogP | 3.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|