C22H34O6 — CID 175964709
5,9-dimethyldec-8-enoic acid;(4-hydroxy-3-methoxyphenyl)methyl acetate (PubChem CID 175964709) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is 5,9-dimethyldec-8-enoic acid;(4-hydroxy-3-methoxyphenyl)methyl acetate.
| Compound Name | 5,9-dimethyldec-8-enoic acid;(4-hydroxy-3-methoxyphenyl)methyl acetate |
|---|---|
| PubChem CID | 175964709 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 5,9-dimethyldec-8-enoic acid;(4-hydroxy-3-methoxyphenyl)methyl acetate |
| SMILES | CC(C)=CCCC(C)CCCC(=O)O.COc1cc(COC(C)=O)ccc1O |
| InChI | InChI=1S/C12H22O2.C10H12O4/c1-10(2)6-4-7-11(3)8-5-9-12(13)14;1-7(11)14-6-8-3-4-9(12)10(5-8)13-2/h6,11H,4-5,7-9H2,1-3H3,(H,13,14);3-5,12H,6H2,1-2H3 |
| InChIKey | DVHCCOSUMGOUEL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|