C20H30O4 — CID 143334764
2-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-5,10-dimethylundec-9-en-3-one (PubChem CID 143334764) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-5,10-dimethylundec-9-en-3-one.
| Compound Name | 2-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-5,10-dimethylundec-9-en-3-one |
|---|---|
| PubChem CID | 143334764 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-5,10-dimethylundec-9-en-3-one |
| SMILES | COc1cc(CC(O)C(=O)CC(C)CCCC=C(C)C)ccc1O |
| InChI | InChI=1S/C20H30O4/c1-14(2)7-5-6-8-15(3)11-18(22)19(23)12-16-9-10-17(21)20(13-16)24-4/h7,9-10,13,15,19,21,23H,5-6,8,11-12H2,1-4H3 |
| InChIKey | LLJXGNUYJRRSMY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|