C26H34O4 — CID 11502444
(5R)-2-hydroxy-1-(3-methoxy-4-phenylmethoxyphenyl)-5,9-dimethyldec-8-en-3-one (PubChem CID 11502444) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (5R)-2-hydroxy-1-(3-methoxy-4-phenylmethoxyphenyl)-5,9-dimethyldec-8-en-3-one.
| Compound Name | (5R)-2-hydroxy-1-(3-methoxy-4-phenylmethoxyphenyl)-5,9-dimethyldec-8-en-3-one |
|---|---|
| PubChem CID | 11502444 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (5R)-2-hydroxy-1-(3-methoxy-4-phenylmethoxyphenyl)-5,9-dimethyldec-8-en-3-one |
| SMILES | COc1cc(CC(O)C(=O)C[C@H](C)CCC=C(C)C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H34O4/c1-19(2)9-8-10-20(3)15-23(27)24(28)16-22-13-14-25(26(17-22)29-4)30-18-21-11-6-5-7-12-21/h5-7,9,11-14,17,20,24,28H,8,10,15-16,18H2,1-4H3/t20-,24?/m1/s1 |
| InChIKey | ZINBGQSXVZGJHV-CGHJUBPDSA-N |
| XLogP | 5.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|