C30H28O5 — CID 23238101
benzyl 3-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxypropanoate (PubChem CID 23238101) has the molecular formula C30H28O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is benzyl 3-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxypropanoate.
| Compound Name | benzyl 3-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 23238101 |
| Molecular Formula | C30H28O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | benzyl 3-[3,4-bis(phenylmethoxy)phenyl]-2-hydroxypropanoate |
| SMILES | O=C(OCc1ccccc1)C(O)Cc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H28O5/c31-27(30(32)35-22-25-14-8-3-9-15-25)18-26-16-17-28(33-20-23-10-4-1-5-11-23)29(19-26)34-21-24-12-6-2-7-13-24/h1-17,19,27,31H,18,20-22H2 |
| InChIKey | XRQNXXNSNDILAM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |